C25H32N4O2 — CID 92765074
(2S)-1-acetyl-N-[3-(4-benzylpiperazin-1-yl)propyl]-2,3-dihydroindole-2-carboxamide (PubChem CID 92765074) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is (2S)-1-acetyl-N-[3-(4-benzylpiperazin-1-yl)propyl]-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-acetyl-N-[3-(4-benzylpiperazin-1-yl)propyl]-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 92765074 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (2S)-1-acetyl-N-[3-(4-benzylpiperazin-1-yl)propyl]-2,3-dihydroindole-2-carboxamide |
| SMILES | CC(=O)N1c2ccccc2C[C@H]1C(=O)NCCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N4O2/c1-20(30)29-23-11-6-5-10-22(23)18-24(29)25(31)26-12-7-13-27-14-16-28(17-15-27)19-21-8-3-2-4-9-21/h2-6,8-11,24H,7,12-19H2,1H3,(H,26,31)/t24-/m0/s1 |
| InChIKey | UKNAWNLYLUONAZ-DEOSSOPVSA-N |
| XLogP | 2.29 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|