C12H14N2O2 — CID 40805370
(2R)-1-acetyl-N-methyl-2,3-dihydroindole-2-carboxamide (PubChem CID 40805370) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (2R)-1-acetyl-N-methyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2R)-1-acetyl-N-methyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 40805370 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (2R)-1-acetyl-N-methyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CNC(=O)[C@H]1Cc2ccccc2N1C(C)=O |
| InChI | InChI=1S/C12H14N2O2/c1-8(15)14-10-6-4-3-5-9(10)7-11(14)12(16)13-2/h3-6,11H,7H2,1-2H3,(H,13,16)/t11-/m1/s1 |
| InChIKey | XKTUHKNIEFAIEF-LLVKDONJSA-N |
| XLogP | 0.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |