C19H20N2O4 — CID 20954315
1-acetyl-N-(3,5-dimethoxyphenyl)-2,3-dihydroindole-2-carboxamide (PubChem CID 20954315) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-acetyl-N-(3,5-dimethoxyphenyl)-2,3-dihydroindole-2-carboxamide.
| Compound Name | 1-acetyl-N-(3,5-dimethoxyphenyl)-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 20954315 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-acetyl-N-(3,5-dimethoxyphenyl)-2,3-dihydroindole-2-carboxamide |
| SMILES | COc1cc(NC(=O)C2Cc3ccccc3N2C(C)=O)cc(OC)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-12(22)21-17-7-5-4-6-13(17)8-18(21)19(23)20-14-9-15(24-2)11-16(10-14)25-3/h4-7,9-11,18H,8H2,1-3H3,(H,20,23) |
| InChIKey | XIQFKBNOIDGZLK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |