C20H34Cl2N4O — CID 119393584
1-benzyl-N-(3-piperazin-1-ylpropyl)piperidine-2-carboxamide;dihydrochloride (PubChem CID 119393584) has the molecular formula C20H34Cl2N4O and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-benzyl-N-(3-piperazin-1-ylpropyl)piperidine-2-carboxamide;dihydrochloride.
| Compound Name | 1-benzyl-N-(3-piperazin-1-ylpropyl)piperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119393584 |
| Molecular Formula | C20H34Cl2N4O |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-benzyl-N-(3-piperazin-1-ylpropyl)piperidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCN1CCNCC1)C1CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H32N4O.2ClH/c25-20(22-10-6-13-23-15-11-21-12-16-23)19-9-4-5-14-24(19)17-18-7-2-1-3-8-18;;/h1-3,7-8,19,21H,4-6,9-17H2,(H,22,25);2*1H |
| InChIKey | WBIAWPXZNRZGFJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|