C17H29Cl2N3O — CID 119433038
1-benzyl-N-[3-(methylamino)propyl]piperidine-2-carboxamide;dihydrochloride (PubChem CID 119433038) has the molecular formula C17H29Cl2N3O and a molecular weight of 362.35 g/mol. Its IUPAC name is 1-benzyl-N-[3-(methylamino)propyl]piperidine-2-carboxamide;dihydrochloride.
| Compound Name | 1-benzyl-N-[3-(methylamino)propyl]piperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119433038 |
| Molecular Formula | C17H29Cl2N3O |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1-benzyl-N-[3-(methylamino)propyl]piperidine-2-carboxamide;dihydrochloride |
| SMILES | CNCCCNC(=O)C1CCCCN1Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H27N3O.2ClH/c1-18-11-7-12-19-17(21)16-10-5-6-13-20(16)14-15-8-3-2-4-9-15;;/h2-4,8-9,16,18H,5-7,10-14H2,1H3,(H,19,21);2*1H |
| InChIKey | PBOAWWJVVLOBIH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|