C13H20N2 — CID 56828058
1-benzyl-7-methyl-1,4-diazepane (PubChem CID 56828058) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-benzyl-7-methyl-1,4-diazepane.
| Compound Name | 1-benzyl-7-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 56828058 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-benzyl-7-methyl-1,4-diazepane |
| SMILES | CC1CCNCCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H20N2/c1-12-7-8-14-9-10-15(12)11-13-5-3-2-4-6-13/h2-6,12,14H,7-11H2,1H3 |
| InChIKey | RGKDAJPPEVSFBH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |