C13H19FN2 — CID 64869395
1-[(4-fluorophenyl)methyl]-7-methyl-1,4-diazepane (PubChem CID 64869395) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-7-methyl-1,4-diazepane.
| Compound Name | 1-[(4-fluorophenyl)methyl]-7-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 64869395 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-7-methyl-1,4-diazepane |
| SMILES | CC1CCNCCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FN2/c1-11-6-7-15-8-9-16(11)10-12-2-4-13(14)5-3-12/h2-5,11,15H,6-10H2,1H3 |
| InChIKey | CCDGZKINIHVQSJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |