C19H25N3 — CID 133483690
4-benzyl-5-methyl-1-(6-methyl-2-pyridinyl)-1,4-diazepane (PubChem CID 133483690) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-benzyl-5-methyl-1-(6-methyl-2-pyridinyl)-1,4-diazepane.
| Compound Name | 4-benzyl-5-methyl-1-(6-methyl-2-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 133483690 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 4-benzyl-5-methyl-1-(6-methyl-2-pyridinyl)-1,4-diazepane |
| SMILES | Cc1cccc(N2CCC(C)N(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H25N3/c1-16-7-6-10-19(20-16)21-12-11-17(2)22(14-13-21)15-18-8-4-3-5-9-18/h3-10,17H,11-15H2,1-2H3 |
| InChIKey | BPEANJZGHUGXNH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |