C16H22N4S — CID 130834693
2-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-1,3-thiazol-5-amine (PubChem CID 130834693) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 2-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-1,3-thiazol-5-amine.
| Compound Name | 2-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 130834693 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-1,3-thiazol-5-amine |
| SMILES | CC1CCN(c2ncc(N)s2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C16H22N4S/c1-13-7-8-19(16-18-11-15(17)21-16)9-10-20(13)12-14-5-3-2-4-6-14/h2-6,11,13H,7-10,12,17H2,1H3 |
| InChIKey | OJHDDFKFCKEGRF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |