C19H24N4O2 — CID 133332394
4-benzyl-5-methyl-1-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepane (PubChem CID 133332394) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-benzyl-5-methyl-1-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepane.
| Compound Name | 4-benzyl-5-methyl-1-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 133332394 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-benzyl-5-methyl-1-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepane |
| SMILES | Cc1cc([N+](=O)[O-])cnc1N1CCC(C)N(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H24N4O2/c1-15-12-18(23(24)25)13-20-19(15)21-9-8-16(2)22(11-10-21)14-17-6-4-3-5-7-17/h3-7,12-13,16H,8-11,14H2,1-2H3 |
| InChIKey | YMOCXVRVPGHCSV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|