C18H21N5 — CID 133484859
5-(4-benzyl-5-methyl-1,4-diazepan-1-yl)pyrazine-2-carbonitrile (PubChem CID 133484859) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-(4-benzyl-5-methyl-1,4-diazepan-1-yl)pyrazine-2-carbonitrile.
| Compound Name | 5-(4-benzyl-5-methyl-1,4-diazepan-1-yl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133484859 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 5-(4-benzyl-5-methyl-1,4-diazepan-1-yl)pyrazine-2-carbonitrile |
| SMILES | CC1CCN(c2cnc(C#N)cn2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C18H21N5/c1-15-7-8-22(18-13-20-17(11-19)12-21-18)9-10-23(15)14-16-5-3-2-4-6-16/h2-6,12-13,15H,7-10,14H2,1H3 |
| InChIKey | YKOZQAYSZZMGTR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |