C23H32N4O2S — CID 133332497
4-benzyl-5-methyl-1-(5-piperidin-1-ylsulfonyl-2-pyridinyl)-1,4-diazepane (PubChem CID 133332497) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is 4-benzyl-5-methyl-1-(5-piperidin-1-ylsulfonyl-2-pyridinyl)-1,4-diazepane.
| Compound Name | 4-benzyl-5-methyl-1-(5-piperidin-1-ylsulfonyl-2-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 133332497 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 4-benzyl-5-methyl-1-(5-piperidin-1-ylsulfonyl-2-pyridinyl)-1,4-diazepane |
| SMILES | CC1CCN(c2ccc(S(=O)(=O)N3CCCCC3)cn2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C23H32N4O2S/c1-20-12-15-25(16-17-26(20)19-21-8-4-2-5-9-21)23-11-10-22(18-24-23)30(28,29)27-13-6-3-7-14-27/h2,4-5,8-11,18,20H,3,6-7,12-17,19H2,1H3 |
| InChIKey | MJGVMJNUCJCZMR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |