C21H27N3O3S — CID 47983366
2-methyl-6-phenyl-4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)morpholine (PubChem CID 47983366) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-methyl-6-phenyl-4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)morpholine.
| Compound Name | 2-methyl-6-phenyl-4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 47983366 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-methyl-6-phenyl-4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)morpholine |
| SMILES | CC1CN(c2ccc(S(=O)(=O)N3CCCCC3)cn2)CC(c2ccccc2)O1 |
| InChI | InChI=1S/C21H27N3O3S/c1-17-15-23(16-20(27-17)18-8-4-2-5-9-18)21-11-10-19(14-22-21)28(25,26)24-12-6-3-7-13-24/h2,4-5,8-11,14,17,20H,3,6-7,12-13,15-16H2,1H3 |
| InChIKey | FSZOBNGTYJRZGK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |