C21H26N2O5S — CID 47913591
(2-methyl-6-phenylmorpholin-4-yl)-(5-piperidin-1-ylsulfonylfuran-2-yl)methanone (PubChem CID 47913591) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is (2-methyl-6-phenylmorpholin-4-yl)-(5-piperidin-1-ylsulfonylfuran-2-yl)methanone.
| Compound Name | (2-methyl-6-phenylmorpholin-4-yl)-(5-piperidin-1-ylsulfonylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 47913591 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2-methyl-6-phenylmorpholin-4-yl)-(5-piperidin-1-ylsulfonylfuran-2-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(S(=O)(=O)N3CCCCC3)o2)CC(c2ccccc2)O1 |
| InChI | InChI=1S/C21H26N2O5S/c1-16-14-22(15-19(27-16)17-8-4-2-5-9-17)21(24)18-10-11-20(28-18)29(25,26)23-12-6-3-7-13-23/h2,4-5,8-11,16,19H,3,6-7,12-15H2,1H3 |
| InChIKey | GHABWWFZVCXVHR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |