C19H27N5O2S — CID 133341841
2-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-5-piperidin-1-ylsulfonylpyridine (PubChem CID 133341841) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 2-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-5-piperidin-1-ylsulfonylpyridine.
| Compound Name | 2-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-5-piperidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 133341841 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-5-piperidin-1-ylsulfonylpyridine |
| SMILES | Cn1cc(CC2CCN(c3ccc(S(=O)(=O)N4CCCCC4)cn3)C2)cn1 |
| InChI | InChI=1S/C19H27N5O2S/c1-22-14-17(12-21-22)11-16-7-10-23(15-16)19-6-5-18(13-20-19)27(25,26)24-8-3-2-4-9-24/h5-6,12-14,16H,2-4,7-11,15H2,1H3 |
| InChIKey | ZHIPJDLHCLJUJJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |