C17H28N4O2S2 — CID 133395006
1-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-3-methylsulfanylazepane (PubChem CID 133395006) has the molecular formula C17H28N4O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-3-methylsulfanylazepane.
| Compound Name | 1-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-3-methylsulfanylazepane |
|---|---|
| PubChem CID | 133395006 |
| Molecular Formula | C17H28N4O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-3-methylsulfanylazepane |
| SMILES | CSC1CCCCN(c2ccc(S(=O)(=O)N3CCN(C)CC3)cn2)C1 |
| InChI | InChI=1S/C17H28N4O2S2/c1-19-9-11-21(12-10-19)25(22,23)16-6-7-17(18-13-16)20-8-4-3-5-15(14-20)24-2/h6-7,13,15H,3-5,8-12,14H2,1-2H3 |
| InChIKey | IYGQGMBMZOUVJZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |