C15H23FN4O2S — CID 139004098
1-[[6-(3-fluoropiperidin-1-yl)-3-pyridinyl]sulfonyl]-4-methylpiperazine (PubChem CID 139004098) has the molecular formula C15H23FN4O2S and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[[6-(3-fluoropiperidin-1-yl)-3-pyridinyl]sulfonyl]-4-methylpiperazine.
| Compound Name | 1-[[6-(3-fluoropiperidin-1-yl)-3-pyridinyl]sulfonyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 139004098 |
| Molecular Formula | C15H23FN4O2S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[[6-(3-fluoropiperidin-1-yl)-3-pyridinyl]sulfonyl]-4-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(N3CCCC(F)C3)nc2)CC1 |
| InChI | InChI=1S/C15H23FN4O2S/c1-18-7-9-20(10-8-18)23(21,22)14-4-5-15(17-11-14)19-6-2-3-13(16)12-19/h4-5,11,13H,2-3,6-10,12H2,1H3 |
| InChIKey | HGBBVQQFZRXPRR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |