C17H26N4O2S — CID 133480963
5-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-5-azaspiro[2.5]octane (PubChem CID 133480963) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 5-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-5-azaspiro[2.5]octane.
| Compound Name | 5-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-5-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 133480963 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 5-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-5-azaspiro[2.5]octane |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(N3CCCC4(CC4)C3)nc2)CC1 |
| InChI | InChI=1S/C17H26N4O2S/c1-19-9-11-21(12-10-19)24(22,23)15-3-4-16(18-13-15)20-8-2-5-17(14-20)6-7-17/h3-4,13H,2,5-12,14H2,1H3 |
| InChIKey | PSOQETUMGPDIIL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |