C14H24N4O2S — CID 5268282
N,N-diethyl-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine (PubChem CID 5268282) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is N,N-diethyl-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | N,N-diethyl-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 5268282 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N,N-diethyl-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N2CCN(C)CC2)cn1 |
| InChI | InChI=1S/C14H24N4O2S/c1-4-17(5-2)14-7-6-13(12-15-14)21(19,20)18-10-8-16(3)9-11-18/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | TUFAYNCUBJZCQX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |