C20H28N4O2S — CID 17470060
N-[(4-ethylphenyl)methyl]-N-methyl-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine (PubChem CID 17470060) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-N-methyl-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | N-[(4-ethylphenyl)methyl]-N-methyl-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 17470060 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-N-methyl-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CCc1ccc(CN(C)c2ccc(S(=O)(=O)N3CCN(C)CC3)cn2)cc1 |
| InChI | InChI=1S/C20H28N4O2S/c1-4-17-5-7-18(8-6-17)16-23(3)20-10-9-19(15-21-20)27(25,26)24-13-11-22(2)12-14-24/h5-10,15H,4,11-14,16H2,1-3H3 |
| InChIKey | DWRFYHLKYBZPDH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |