C20H28N4O2S — CID 133385878
N-[[3-(dimethylamino)phenyl]methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-2-amine (PubChem CID 133385878) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is N-[[3-(dimethylamino)phenyl]methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[[3-(dimethylamino)phenyl]methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 133385878 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[[3-(dimethylamino)phenyl]methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-2-amine |
| SMILES | CN(C)c1cccc(CN(C)c2ccc(S(=O)(=O)N3CCCCC3)cn2)c1 |
| InChI | InChI=1S/C20H28N4O2S/c1-22(2)18-9-7-8-17(14-18)16-23(3)20-11-10-19(15-21-20)27(25,26)24-12-5-4-6-13-24/h7-11,14-15H,4-6,12-13,16H2,1-3H3 |
| InChIKey | DLHGSTOFNAENQA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |