C19H24FN3O3S — CID 31920963
N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-2-amine (PubChem CID 31920963) has the molecular formula C19H24FN3O3S and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 31920963 |
| Molecular Formula | C19H24FN3O3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-2-amine |
| SMILES | COc1ccc(CN(C)c2ccc(S(=O)(=O)N3CCCCC3)cn2)cc1F |
| InChI | InChI=1S/C19H24FN3O3S/c1-22(14-15-6-8-18(26-2)17(20)12-15)19-9-7-16(13-21-19)27(24,25)23-10-4-3-5-11-23/h6-9,12-13H,3-5,10-11,14H2,1-2H3 |
| InChIKey | FJLLOKKDOXEMFJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |