C14H14ClFN2O3S — CID 39794843
6-chloro-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpyridine-3-sulfonamide (PubChem CID 39794843) has the molecular formula C14H14ClFN2O3S and a molecular weight of 344.80 g/mol. Its IUPAC name is 6-chloro-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 39794843 |
| Molecular Formula | C14H14ClFN2O3S |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 6-chloro-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpyridine-3-sulfonamide |
| SMILES | COc1ccc(CN(C)S(=O)(=O)c2ccc(Cl)nc2)cc1F |
| InChI | InChI=1S/C14H14ClFN2O3S/c1-18(9-10-3-5-13(21-2)12(16)7-10)22(19,20)11-4-6-14(15)17-8-11/h3-8H,9H2,1-2H3 |
| InChIKey | ADIAAPJUCADHGB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|