C10H14FNO3S — CID 60681417
N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylmethanesulfonamide (PubChem CID 60681417) has the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 60681417 |
| Molecular Formula | C10H14FNO3S |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylmethanesulfonamide |
| SMILES | COc1ccc(CN(C)S(C)(=O)=O)cc1F |
| InChI | InChI=1S/C10H14FNO3S/c1-12(16(3,13)14)7-8-4-5-10(15-2)9(11)6-8/h4-6H,7H2,1-3H3 |
| InChIKey | UVMWVRDJMVRXJS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |