C15H25N3O5S — CID 55346673
N,N-bis(2-methoxyethyl)-5-morpholin-4-ylsulfonylpyridin-2-amine (PubChem CID 55346673) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-5-morpholin-4-ylsulfonylpyridin-2-amine.
| Compound Name | N,N-bis(2-methoxyethyl)-5-morpholin-4-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 55346673 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-5-morpholin-4-ylsulfonylpyridin-2-amine |
| SMILES | COCCN(CCOC)c1ccc(S(=O)(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C15H25N3O5S/c1-21-9-5-17(6-10-22-2)15-4-3-14(13-16-15)24(19,20)18-7-11-23-12-8-18/h3-4,13H,5-12H2,1-2H3 |
| InChIKey | CRSJONYIHMDNIT-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |