C17H26N2O7S — CID 4064757
N-(2-hydroxyethyl)-N-(2-methoxyethyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide (PubChem CID 4064757) has the molecular formula C17H26N2O7S and a molecular weight of 402.47 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(2-methoxyethyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide.
| Compound Name | N-(2-hydroxyethyl)-N-(2-methoxyethyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 4064757 |
| Molecular Formula | C17H26N2O7S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(2-methoxyethyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide |
| SMILES | COCCN(CCO)C(=O)COc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H26N2O7S/c1-24-11-7-18(6-10-20)17(21)14-26-15-2-4-16(5-3-15)27(22,23)19-8-12-25-13-9-19/h2-5,20H,6-14H2,1H3 |
| InChIKey | XLRSBYJZRCFUAQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |