C16H25ClN2O6S — CID 119912747
2-[methyl-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]amino]propanoic acid;hydrochloride (PubChem CID 119912747) has the molecular formula C16H25ClN2O6S and a molecular weight of 408.90 g/mol. Its IUPAC name is 2-[methyl-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 2-[methyl-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119912747 |
| Molecular Formula | C16H25ClN2O6S |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[methyl-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]amino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CCOc1ccc(S(=O)(=O)N2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C16H24N2O6S.ClH/c1-13(16(19)20)17(2)7-12-24-14-3-5-15(6-4-14)25(21,22)18-8-10-23-11-9-18;/h3-6,13H,7-12H2,1-2H3,(H,19,20);1H |
| InChIKey | DCKFBBCIHARONR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |