C18H24N3O4S+ — CID 9113165
N-methyl-5-morpholin-4-ylsulfonyl-N-(2-phenoxyethyl)pyridin-1-ium-2-amine (PubChem CID 9113165) has the molecular formula C18H24N3O4S+ and a molecular weight of 378.47 g/mol. Its IUPAC name is N-methyl-5-morpholin-4-ylsulfonyl-N-(2-phenoxyethyl)pyridin-1-ium-2-amine.
| Compound Name | N-methyl-5-morpholin-4-ylsulfonyl-N-(2-phenoxyethyl)pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9113165 |
| Molecular Formula | C18H24N3O4S+ |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-methyl-5-morpholin-4-ylsulfonyl-N-(2-phenoxyethyl)pyridin-1-ium-2-amine |
| SMILES | CN(CCOc1ccccc1)c1ccc(S(=O)(=O)N2CCOCC2)c[nH+]1 |
| InChI | InChI=1S/C18H23N3O4S/c1-20(9-14-25-16-5-3-2-4-6-16)18-8-7-17(15-19-18)26(22,23)21-10-12-24-13-11-21/h2-8,15H,9-14H2,1H3/p+1 |
| InChIKey | OZKNTXXPSJHKJU-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 73.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |