C19H25N3O5S — CID 55829731
N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-5-morpholin-4-ylsulfonylpyridin-2-amine (PubChem CID 55829731) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-5-morpholin-4-ylsulfonylpyridin-2-amine.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-5-morpholin-4-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 55829731 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-5-morpholin-4-ylsulfonylpyridin-2-amine |
| SMILES | COc1ccccc1OCCN(C)c1ccc(S(=O)(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C19H25N3O5S/c1-21(9-14-27-18-6-4-3-5-17(18)25-2)19-8-7-16(15-20-19)28(23,24)22-10-12-26-13-11-22/h3-8,15H,9-14H2,1-2H3 |
| InChIKey | ZPKGCHOPSVEVGF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |