C18H23N3O5S2 — CID 55353222
N-methyl-4-morpholin-4-ylsulfonyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide (PubChem CID 55353222) has the molecular formula C18H23N3O5S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-methyl-4-morpholin-4-ylsulfonyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide.
| Compound Name | N-methyl-4-morpholin-4-ylsulfonyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55353222 |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-methyl-4-morpholin-4-ylsulfonyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
| SMILES | CN(CCc1ccccn1)S(=O)(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H23N3O5S2/c1-20(11-9-16-4-2-3-10-19-16)27(22,23)17-5-7-18(8-6-17)28(24,25)21-12-14-26-15-13-21/h2-8,10H,9,11-15H2,1H3 |
| InChIKey | OBUQQOPLGDSVMI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |