C19H26N5O4S+ — CID 7923071
N-methyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-nitro-N-(2-pyridin-2-ylethyl)aniline (PubChem CID 7923071) has the molecular formula C19H26N5O4S+ and a molecular weight of 420.52 g/mol. Its IUPAC name is N-methyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-nitro-N-(2-pyridin-2-ylethyl)aniline.
| Compound Name | N-methyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-nitro-N-(2-pyridin-2-ylethyl)aniline |
|---|---|
| PubChem CID | 7923071 |
| Molecular Formula | C19H26N5O4S+ |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-methyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-nitro-N-(2-pyridin-2-ylethyl)aniline |
| SMILES | CN(CCc1ccccn1)c1ccc(S(=O)(=O)N2CC[NH+](C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N5O4S/c1-21-11-13-23(14-12-21)29(27,28)17-6-7-18(19(15-17)24(25)26)22(2)10-8-16-5-3-4-9-20-16/h3-7,9,15H,8,10-14H2,1-2H3/p+1 |
| InChIKey | MJYPBGAYIGMGAC-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|