C14H16N4O4S — CID 133462710
2-[methyl(2-pyridin-2-ylethyl)amino]-4-nitrobenzenesulfonamide (PubChem CID 133462710) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-[methyl(2-pyridin-2-ylethyl)amino]-4-nitrobenzenesulfonamide.
| Compound Name | 2-[methyl(2-pyridin-2-ylethyl)amino]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133462710 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[methyl(2-pyridin-2-ylethyl)amino]-4-nitrobenzenesulfonamide |
| SMILES | CN(CCc1ccccn1)c1cc([N+](=O)[O-])ccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H16N4O4S/c1-17(9-7-11-4-2-3-8-16-11)13-10-12(18(19)20)5-6-14(13)23(15,21)22/h2-6,8,10H,7,9H2,1H3,(H2,15,21,22) |
| InChIKey | CTOSECHLJYESEC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|