C13H24N2 — CID 142585406
ethane;N-methyl-N-(2-pyridin-2-ylethyl)propan-2-amine (PubChem CID 142585406) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;N-methyl-N-(2-pyridin-2-ylethyl)propan-2-amine.
| Compound Name | ethane;N-methyl-N-(2-pyridin-2-ylethyl)propan-2-amine |
|---|---|
| PubChem CID | 142585406 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;N-methyl-N-(2-pyridin-2-ylethyl)propan-2-amine |
| SMILES | CC.CC(C)N(C)CCc1ccccn1 |
| InChI | InChI=1S/C11H18N2.C2H6/c1-10(2)13(3)9-7-11-6-4-5-8-12-11;1-2/h4-6,8,10H,7,9H2,1-3H3;1-2H3 |
| InChIKey | MDBXOVDPYFVEIU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |