C12H19N3S — CID 60915227
3-[methyl(2-pyridin-2-ylethyl)amino]butanethioamide (PubChem CID 60915227) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-[methyl(2-pyridin-2-ylethyl)amino]butanethioamide.
| Compound Name | 3-[methyl(2-pyridin-2-ylethyl)amino]butanethioamide |
|---|---|
| PubChem CID | 60915227 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-[methyl(2-pyridin-2-ylethyl)amino]butanethioamide |
| SMILES | CC(CC(N)=S)N(C)CCc1ccccn1 |
| InChI | InChI=1S/C12H19N3S/c1-10(9-12(13)16)15(2)8-6-11-5-3-4-7-14-11/h3-5,7,10H,6,8-9H2,1-2H3,(H2,13,16) |
| InChIKey | YNLBAUFFRLUXCV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|