C11H17N3S — CID 60914342
3-[methyl(pyridin-2-ylmethyl)amino]butanethioamide (PubChem CID 60914342) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-[methyl(pyridin-2-ylmethyl)amino]butanethioamide.
| Compound Name | 3-[methyl(pyridin-2-ylmethyl)amino]butanethioamide |
|---|---|
| PubChem CID | 60914342 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-[methyl(pyridin-2-ylmethyl)amino]butanethioamide |
| SMILES | CC(CC(N)=S)N(C)Cc1ccccn1 |
| InChI | InChI=1S/C11H17N3S/c1-9(7-11(12)15)14(2)8-10-5-3-4-6-13-10/h3-6,9H,7-8H2,1-2H3,(H2,12,15) |
| InChIKey | AEQYAPVAYQRJIS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|