C11H19N3 — CID 60914164
3-N-methyl-3-N-(pyridin-2-ylmethyl)butane-1,3-diamine (PubChem CID 60914164) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-N-methyl-3-N-(pyridin-2-ylmethyl)butane-1,3-diamine.
| Compound Name | 3-N-methyl-3-N-(pyridin-2-ylmethyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 60914164 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3-N-methyl-3-N-(pyridin-2-ylmethyl)butane-1,3-diamine |
| SMILES | CC(CCN)N(C)Cc1ccccn1 |
| InChI | InChI=1S/C11H19N3/c1-10(6-7-12)14(2)9-11-5-3-4-8-13-11/h3-5,8,10H,6-7,9,12H2,1-2H3 |
| InChIKey | QMLCSCCABLRVFX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |