C12H16F2N2S — CID 55176274
3-[(2,3-difluorophenyl)methyl-methylamino]butanethioamide (PubChem CID 55176274) has the molecular formula C12H16F2N2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)methyl-methylamino]butanethioamide.
| Compound Name | 3-[(2,3-difluorophenyl)methyl-methylamino]butanethioamide |
|---|---|
| PubChem CID | 55176274 |
| Molecular Formula | C12H16F2N2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-[(2,3-difluorophenyl)methyl-methylamino]butanethioamide |
| SMILES | CC(CC(N)=S)N(C)Cc1cccc(F)c1F |
| InChI | InChI=1S/C12H16F2N2S/c1-8(6-11(15)17)16(2)7-9-4-3-5-10(13)12(9)14/h3-5,8H,6-7H2,1-2H3,(H2,15,17) |
| InChIKey | UMWFESNEYXEROG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|