About N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine
N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine (PubChem CID 91709658) has the molecular formula C11H20N2Si
and a molecular weight of 208.38 g/mol. Its IUPAC name is N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine.
Molecular Properties
| Compound Name | N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine |
| PubChem CID | 91709658 |
| Molecular Formula | C11H20N2Si |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine |
| SMILES | CN(CCc1ccccn1)[Si](C)(C)C |
| InChI | InChI=1S/C11H20N2Si/c1-13(14(2,3)4)10-8-11-7-5-6-9-12-11/h5-7,9H,8,10H2,1-4H3 |
| InChIKey | HMGNWIQKUIKKKB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine?
The IUPAC name of N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine (CID 91709658) is N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine.
What is the SMILES notation for N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine?
The canonical SMILES for N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine is CN(CCc1ccccn1)[Si](C)(C)C.
What is the InChIKey of N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine?
The InChIKey is HMGNWIQKUIKKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2Si/c1-13(14(2,3)4)10-8-11-7-5-6-9-12-11/h5-7,9H,8,10H2,1-4H3.
What are the key properties of N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine?
N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine has a molecular weight of 208.38 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-pyridin-2-yl-N-trimethylsilylethanamine is sourced from PubChem (CID 91709658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).