C13H20N2 — CID 757307
(E)-N,2-dimethyl-N-(2-pyridin-2-ylethyl)but-2-en-1-amine (PubChem CID 757307) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (E)-N,2-dimethyl-N-(2-pyridin-2-ylethyl)but-2-en-1-amine.
| Compound Name | (E)-N,2-dimethyl-N-(2-pyridin-2-ylethyl)but-2-en-1-amine |
|---|---|
| PubChem CID | 757307 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (E)-N,2-dimethyl-N-(2-pyridin-2-ylethyl)but-2-en-1-amine |
| SMILES | C/C=C(\C)CN(C)CCc1ccccn1 |
| InChI | InChI=1S/C13H20N2/c1-4-12(2)11-15(3)10-8-13-7-5-6-9-14-13/h4-7,9H,8,10-11H2,1-3H3/b12-4+ |
| InChIKey | LYAKXFMRGVRFNM-UUILKARUSA-N |
| XLogP | 2.52 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|