C13H21ClN2 — CID 61289139
5-chloro-N-methyl-N-(2-pyridin-2-ylethyl)pentan-1-amine (PubChem CID 61289139) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-(2-pyridin-2-ylethyl)pentan-1-amine.
| Compound Name | 5-chloro-N-methyl-N-(2-pyridin-2-ylethyl)pentan-1-amine |
|---|---|
| PubChem CID | 61289139 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-chloro-N-methyl-N-(2-pyridin-2-ylethyl)pentan-1-amine |
| SMILES | CN(CCCCCCl)CCc1ccccn1 |
| InChI | InChI=1S/C13H21ClN2/c1-16(11-6-2-4-9-14)12-8-13-7-3-5-10-15-13/h3,5,7,10H,2,4,6,8-9,11-12H2,1H3 |
| InChIKey | LWKHQKMLMOPCRA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|