C17H31N3 — CID 62419001
N-tert-butyl-N'-methyl-N'-(2-pyridin-2-ylethyl)pentane-1,5-diamine (PubChem CID 62419001) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is N-tert-butyl-N'-methyl-N'-(2-pyridin-2-ylethyl)pentane-1,5-diamine.
| Compound Name | N-tert-butyl-N'-methyl-N'-(2-pyridin-2-ylethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 62419001 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N-tert-butyl-N'-methyl-N'-(2-pyridin-2-ylethyl)pentane-1,5-diamine |
| SMILES | CN(CCCCCNC(C)(C)C)CCc1ccccn1 |
| InChI | InChI=1S/C17H31N3/c1-17(2,3)19-13-7-5-9-14-20(4)15-11-16-10-6-8-12-18-16/h6,8,10,12,19H,5,7,9,11,13-15H2,1-4H3 |
| InChIKey | JIWZNSNZIIBPGS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|