C18H26N2Si — CID 103438267
N-methyl-2-pyridin-2-yl-N-[(4-trimethylsilylphenyl)methyl]ethanamine (PubChem CID 103438267) has the molecular formula C18H26N2Si and a molecular weight of 298.51 g/mol. Its IUPAC name is N-methyl-2-pyridin-2-yl-N-[(4-trimethylsilylphenyl)methyl]ethanamine.
| Compound Name | N-methyl-2-pyridin-2-yl-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103438267 |
| Molecular Formula | C18H26N2Si |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N-methyl-2-pyridin-2-yl-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
| SMILES | CN(CCc1ccccn1)Cc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2Si/c1-20(14-12-17-7-5-6-13-19-17)15-16-8-10-18(11-9-16)21(2,3)4/h5-11,13H,12,14-15H2,1-4H3 |
| InChIKey | UOEDNZNQNAEKMM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|