C23H22BrN7O4S — CID 75215391
N-[1-(5-bromopyrazolo[1,5-a]pyridin-3-yl)ethylideneamino]-2-[methyl(2-pyridin-2-ylethyl)amino]-5-nitrobenzenesulfonamide (PubChem CID 75215391) has the molecular formula C23H22BrN7O4S and a molecular weight of 572.45 g/mol. Its IUPAC name is N-[1-(5-bromopyrazolo[1,5-a]pyridin-3-yl)ethylideneamino]-2-[methyl(2-pyridin-2-ylethyl)amino]-5-nitrobenzenesulfonamide.
| Compound Name | N-[1-(5-bromopyrazolo[1,5-a]pyridin-3-yl)ethylideneamino]-2-[methyl(2-pyridin-2-ylethyl)amino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 75215391 |
| Molecular Formula | C23H22BrN7O4S |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 571.06 |
| IUPAC Name | N-[1-(5-bromopyrazolo[1,5-a]pyridin-3-yl)ethylideneamino]-2-[methyl(2-pyridin-2-ylethyl)amino]-5-nitrobenzenesulfonamide |
| SMILES | CC(=NNS(=O)(=O)c1cc([N+](=O)[O-])ccc1N(C)CCc1ccccn1)c1cnn2ccc(Br)cc12 |
| InChI | InChI=1S/C23H22BrN7O4S/c1-16(20-15-26-30-12-8-17(24)13-22(20)30)27-28-36(34,35)23-14-19(31(32)33)6-7-21(23)29(2)11-9-18-5-3-4-10-25-18/h3-8,10,12-15,28H,9,11H2,1-2H3 |
| InChIKey | KYEJKLKZTHCEPM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|