C17H16N4O6S — CID 90556763
ethyl 5-[(2-methyl-5-nitrophenyl)sulfonylamino]pyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 90556763) has the molecular formula C17H16N4O6S and a molecular weight of 404.40 g/mol. Its IUPAC name is ethyl 5-[(2-methyl-5-nitrophenyl)sulfonylamino]pyrazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[(2-methyl-5-nitrophenyl)sulfonylamino]pyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90556763 |
| Molecular Formula | C17H16N4O6S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | ethyl 5-[(2-methyl-5-nitrophenyl)sulfonylamino]pyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2ccc(NS(=O)(=O)c3cc([N+](=O)[O-])ccc3C)cc12 |
| InChI | InChI=1S/C17H16N4O6S/c1-3-27-17(22)14-10-18-20-7-6-12(8-15(14)20)19-28(25,26)16-9-13(21(23)24)5-4-11(16)2/h4-10,19H,3H2,1-2H3 |
| InChIKey | CVWZAWYJJQFJCO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|