C22H18N2O7S — CID 3311794
phenacyl 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate (PubChem CID 3311794) has the molecular formula C22H18N2O7S and a molecular weight of 454.46 g/mol. Its IUPAC name is phenacyl 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | phenacyl 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3311794 |
| Molecular Formula | C22H18N2O7S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | phenacyl 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccccc1C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O7S/c1-15-11-12-17(24(27)28)13-21(15)32(29,30)23-19-10-6-5-9-18(19)22(26)31-14-20(25)16-7-3-2-4-8-16/h2-13,23H,14H2,1H3 |
| InChIKey | WCWZBDDWBBZQRY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|