C27H31N3O7S — CID 4966747
[2-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]-2-oxoethyl] 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate (PubChem CID 4966747) has the molecular formula C27H31N3O7S and a molecular weight of 541.63 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]-2-oxoethyl] 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [2-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]-2-oxoethyl] 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4966747 |
| Molecular Formula | C27H31N3O7S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | [2-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]-2-oxoethyl] 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccccc1C(=O)OCC(=O)c1cc(C)n(CCC(C)C)c1C |
| InChI | InChI=1S/C27H31N3O7S/c1-17(2)12-13-29-19(4)14-23(20(29)5)25(31)16-37-27(32)22-8-6-7-9-24(22)28-38(35,36)26-15-21(30(33)34)11-10-18(26)3/h6-11,14-15,17,28H,12-13,16H2,1-5H3 |
| InChIKey | WJIPGQFZVBAXSO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|