C23H20N2O7S — CID 42983014
[2-(3,4-dimethylphenyl)-2-oxoethyl] 2-[(3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 42983014) has the molecular formula C23H20N2O7S and a molecular weight of 468.49 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] 2-[(3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 2-[(3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 42983014 |
| Molecular Formula | C23H20N2O7S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 2-[(3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccccc2NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C23H20N2O7S/c1-15-10-11-17(12-16(15)2)22(26)14-32-23(27)20-8-3-4-9-21(20)24-33(30,31)19-7-5-6-18(13-19)25(28)29/h3-13,24H,14H2,1-2H3 |
| InChIKey | BMFNCTYYXOMKAV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|