C19H23N3O7S — CID 55531044
N,N-bis(2-methoxyethyl)-2-[(3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 55531044) has the molecular formula C19H23N3O7S and a molecular weight of 437.47 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-2-[(3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N,N-bis(2-methoxyethyl)-2-[(3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 55531044 |
| Molecular Formula | C19H23N3O7S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-2-[(3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | COCCN(CCOC)C(=O)c1ccccc1NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N3O7S/c1-28-12-10-21(11-13-29-2)19(23)17-8-3-4-9-18(17)20-30(26,27)16-7-5-6-15(14-16)22(24)25/h3-9,14,20H,10-13H2,1-2H3 |
| InChIKey | XFUPVEOGTNTFJU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|