C19H19N5O6S — CID 56509825
N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-N-methyl-2-[(3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 56509825) has the molecular formula C19H19N5O6S and a molecular weight of 445.46 g/mol. Its IUPAC name is N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-N-methyl-2-[(3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-N-methyl-2-[(3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 56509825 |
| Molecular Formula | C19H19N5O6S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-N-methyl-2-[(3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | CCc1noc(CN(C)C(=O)c2ccccc2NS(=O)(=O)c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H19N5O6S/c1-3-17-20-18(30-21-17)12-23(2)19(25)15-9-4-5-10-16(15)22-31(28,29)14-8-6-7-13(11-14)24(26)27/h4-11,22H,3,12H2,1-2H3 |
| InChIKey | JVDXGOGUBJFPSC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|