C14H19N5O5S — CID 120868800
N-[2-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzenesulfonamide (PubChem CID 120868800) has the molecular formula C14H19N5O5S and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[2-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120868800 |
| Molecular Formula | C14H19N5O5S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[2-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzenesulfonamide |
| SMILES | CNC(C)Cc1noc(CCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H19N5O5S/c1-10(15-2)8-13-17-14(24-18-13)6-7-16-25(22,23)12-5-3-4-11(9-12)19(20)21/h3-5,9-10,15-16H,6-8H2,1-2H3 |
| InChIKey | YOASDNDRZZJICI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|